C12H12FN5OS — CID 7801887
N-cyclopropyl-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 7801887) has the molecular formula C12H12FN5OS and a molecular weight of 293.33 g/mol. Its IUPAC name is N-cyclopropyl-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-cyclopropyl-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 7801887 |
| Molecular Formula | C12H12FN5OS |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | N-cyclopropyl-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1-c1cccc(F)c1)NC1CC1 |
| InChI | InChI=1S/C12H12FN5OS/c13-8-2-1-3-10(6-8)18-12(15-16-17-18)20-7-11(19)14-9-4-5-9/h1-3,6,9H,4-5,7H2,(H,14,19) |
| InChIKey | RKRRRWXRDXRCEW-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |