C10H13NO4 — CID 78018913
methyl 1-(2-hydroxypropyl)-6-oxopyridine-3-carboxylate (PubChem CID 78018913) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is methyl 1-(2-hydroxypropyl)-6-oxopyridine-3-carboxylate.
| Compound Name | methyl 1-(2-hydroxypropyl)-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 78018913 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | methyl 1-(2-hydroxypropyl)-6-oxopyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(=O)n(CC(C)O)c1 |
| InChI | InChI=1S/C10H13NO4/c1-7(12)5-11-6-8(10(14)15-2)3-4-9(11)13/h3-4,6-7,12H,5H2,1-2H3 |
| InChIKey | JAVYORPQAAVDJR-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |