C15H15N5O3 — CID 780214
2-[(6-ethoxy-4-methylquinazolin-2-yl)amino]-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 780214) has the molecular formula C15H15N5O3 and a molecular weight of 313.32 g/mol. Its IUPAC name is 2-[(6-ethoxy-4-methylquinazolin-2-yl)amino]-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 2-[(6-ethoxy-4-methylquinazolin-2-yl)amino]-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 780214 |
| Molecular Formula | C15H15N5O3 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-[(6-ethoxy-4-methylquinazolin-2-yl)amino]-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | CCOc1ccc2nc(Nc3nc(O)cc(=O)[nH]3)nc(C)c2c1 |
| InChI | InChI=1S/C15H15N5O3/c1-3-23-9-4-5-11-10(6-9)8(2)16-14(17-11)20-15-18-12(21)7-13(22)19-15/h4-7H,3H2,1-2H3,(H3,16,17,18,19,20,21,22) |
| InChIKey | GSZJFVYWYBIRNS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |