About 1,5-diphenyl-3-thiophen-2-ylpentane-1,5-dione
1,5-diphenyl-3-thiophen-2-ylpentane-1,5-dione (PubChem CID 780235) has the molecular formula C21H18O2S
and a molecular weight of 334.44 g/mol. Its IUPAC name is 1,5-diphenyl-3-thiophen-2-ylpentane-1,5-dione.
Molecular Properties
| Compound Name | 1,5-diphenyl-3-thiophen-2-ylpentane-1,5-dione |
| PubChem CID | 780235 |
| Molecular Formula | C21H18O2S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 1,5-diphenyl-3-thiophen-2-ylpentane-1,5-dione |
| SMILES | O=C(CC(CC(=O)c1ccccc1)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C21H18O2S/c22-19(16-8-3-1-4-9-16)14-18(21-12-7-13-24-21)15-20(23)17-10-5-2-6-11-17/h1-13,18H,14-15H2 |
| InChIKey | SUQWIRAGCUTYMZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,5-diphenyl-3-thiophen-2-ylpentane-1,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-diphenyl-3-thiophen-2-ylpentane-1,5-dione?
The IUPAC name of 1,5-diphenyl-3-thiophen-2-ylpentane-1,5-dione (CID 780235) is 1,5-diphenyl-3-thiophen-2-ylpentane-1,5-dione.
What is the SMILES notation for 1,5-diphenyl-3-thiophen-2-ylpentane-1,5-dione?
The canonical SMILES for 1,5-diphenyl-3-thiophen-2-ylpentane-1,5-dione is O=C(CC(CC(=O)c1ccccc1)c1cccs1)c1ccccc1.
What is the InChIKey of 1,5-diphenyl-3-thiophen-2-ylpentane-1,5-dione?
The InChIKey is SUQWIRAGCUTYMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18O2S/c22-19(16-8-3-1-4-9-16)14-18(21-12-7-13-24-21)15-20(23)17-10-5-2-6-11-17/h1-13,18H,14-15H2.
What are the key properties of 1,5-diphenyl-3-thiophen-2-ylpentane-1,5-dione?
1,5-diphenyl-3-thiophen-2-ylpentane-1,5-dione has a molecular weight of 334.44 g/mol, XLogP of 5.38, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-diphenyl-3-thiophen-2-ylpentane-1,5-dione is sourced from PubChem (CID 780235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).