About 1-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-5-(trifluoromethyl)pyridin-2-one
1-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 7802597) has the molecular formula C17H16F3NO2
and a molecular weight of 323.31 g/mol. Its IUPAC name is 1-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-5-(trifluoromethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 1-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-5-(trifluoromethyl)pyridin-2-one |
| PubChem CID | 7802597 |
| Molecular Formula | C17H16F3NO2 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 1-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | Cc1cc(C)c(C(=O)Cn2cc(C(F)(F)F)ccc2=O)cc1C |
| InChI | InChI=1S/C17H16F3NO2/c1-10-6-12(3)14(7-11(10)2)15(22)9-21-8-13(17(18,19)20)4-5-16(21)23/h4-8H,9H2,1-3H3 |
| InChIKey | ZZZZJOSURXTPPI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-5-(trifluoromethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-5-(trifluoromethyl)pyridin-2-one?
The IUPAC name of 1-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-5-(trifluoromethyl)pyridin-2-one (CID 7802597) is 1-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-5-(trifluoromethyl)pyridin-2-one.
What is the SMILES notation for 1-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-5-(trifluoromethyl)pyridin-2-one?
The canonical SMILES for 1-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-5-(trifluoromethyl)pyridin-2-one is Cc1cc(C)c(C(=O)Cn2cc(C(F)(F)F)ccc2=O)cc1C.
What is the InChIKey of 1-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-5-(trifluoromethyl)pyridin-2-one?
The InChIKey is ZZZZJOSURXTPPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F3NO2/c1-10-6-12(3)14(7-11(10)2)15(22)9-21-8-13(17(18,19)20)4-5-16(21)23/h4-8H,9H2,1-3H3.
What are the key properties of 1-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-5-(trifluoromethyl)pyridin-2-one?
1-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-5-(trifluoromethyl)pyridin-2-one has a molecular weight of 323.31 g/mol, XLogP of 3.68, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-5-(trifluoromethyl)pyridin-2-one is sourced from PubChem (CID 7802597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).