About (E)-3-(1,3-benzoxazol-2-yl)-4-[4-(trifluoromethyl)phenyl]but-3-enoate
(E)-3-(1,3-benzoxazol-2-yl)-4-[4-(trifluoromethyl)phenyl]but-3-enoate (PubChem CID 7802638) has the molecular formula C18H11F3NO3-
and a molecular weight of 346.28 g/mol. Its IUPAC name is (E)-3-(1,3-benzoxazol-2-yl)-4-[4-(trifluoromethyl)phenyl]but-3-enoate.
Molecular Properties
| Compound Name | (E)-3-(1,3-benzoxazol-2-yl)-4-[4-(trifluoromethyl)phenyl]but-3-enoate |
| PubChem CID | 7802638 |
| Molecular Formula | C18H11F3NO3- |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | (E)-3-(1,3-benzoxazol-2-yl)-4-[4-(trifluoromethyl)phenyl]but-3-enoate |
| SMILES | O=C([O-])C/C(=C\c1ccc(C(F)(F)F)cc1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C18H12F3NO3/c19-18(20,21)13-7-5-11(6-8-13)9-12(10-16(23)24)17-22-14-3-1-2-4-15(14)25-17/h1-9H,10H2,(H,23,24)/p-1/b12-9+ |
| InChIKey | MFZSACFOOXAQTO-FMIVXFBMSA-M |
| XLogP | 3.53 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (E)-3-(1,3-benzoxazol-2-yl)-4-[4-(trifluoromethyl)phenyl]but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(1,3-benzoxazol-2-yl)-4-[4-(trifluoromethyl)phenyl]but-3-enoate?
The IUPAC name of (E)-3-(1,3-benzoxazol-2-yl)-4-[4-(trifluoromethyl)phenyl]but-3-enoate (CID 7802638) is (E)-3-(1,3-benzoxazol-2-yl)-4-[4-(trifluoromethyl)phenyl]but-3-enoate.
What is the SMILES notation for (E)-3-(1,3-benzoxazol-2-yl)-4-[4-(trifluoromethyl)phenyl]but-3-enoate?
The canonical SMILES for (E)-3-(1,3-benzoxazol-2-yl)-4-[4-(trifluoromethyl)phenyl]but-3-enoate is O=C([O-])C/C(=C\c1ccc(C(F)(F)F)cc1)c1nc2ccccc2o1.
What is the InChIKey of (E)-3-(1,3-benzoxazol-2-yl)-4-[4-(trifluoromethyl)phenyl]but-3-enoate?
The InChIKey is MFZSACFOOXAQTO-FMIVXFBMSA-M. The full InChI is InChI=1S/C18H12F3NO3/c19-18(20,21)13-7-5-11(6-8-13)9-12(10-16(23)24)17-22-14-3-1-2-4-15(14)25-17/h1-9H,10H2,(H,23,24)/p-1/b12-9+.
What are the key properties of (E)-3-(1,3-benzoxazol-2-yl)-4-[4-(trifluoromethyl)phenyl]but-3-enoate?
(E)-3-(1,3-benzoxazol-2-yl)-4-[4-(trifluoromethyl)phenyl]but-3-enoate has a molecular weight of 346.28 g/mol, XLogP of 3.53, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(1,3-benzoxazol-2-yl)-4-[4-(trifluoromethyl)phenyl]but-3-enoate is sourced from PubChem (CID 7802638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).