About N-cyclohexyl-4-methylcyclohepta-1,3-diene-1-sulfinamide
N-cyclohexyl-4-methylcyclohepta-1,3-diene-1-sulfinamide (PubChem CID 78027194) has the molecular formula C14H23NOS
and a molecular weight of 253.41 g/mol. Its IUPAC name is N-cyclohexyl-4-methylcyclohepta-1,3-diene-1-sulfinamide.
Molecular Properties
| Compound Name | N-cyclohexyl-4-methylcyclohepta-1,3-diene-1-sulfinamide |
| PubChem CID | 78027194 |
| Molecular Formula | C14H23NOS |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | N-cyclohexyl-4-methylcyclohepta-1,3-diene-1-sulfinamide |
| SMILES | CC1=CC=C(S(=O)NC2CCCCC2)CCC1 |
| InChI | InChI=1S/C14H23NOS/c1-12-6-5-9-14(11-10-12)17(16)15-13-7-3-2-4-8-13/h10-11,13,15H,2-9H2,1H3 |
| InChIKey | UEHUTJDICNFQDT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclohexyl-4-methylcyclohepta-1,3-diene-1-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-4-methylcyclohepta-1,3-diene-1-sulfinamide?
The IUPAC name of N-cyclohexyl-4-methylcyclohepta-1,3-diene-1-sulfinamide (CID 78027194) is N-cyclohexyl-4-methylcyclohepta-1,3-diene-1-sulfinamide.
What is the SMILES notation for N-cyclohexyl-4-methylcyclohepta-1,3-diene-1-sulfinamide?
The canonical SMILES for N-cyclohexyl-4-methylcyclohepta-1,3-diene-1-sulfinamide is CC1=CC=C(S(=O)NC2CCCCC2)CCC1.
What is the InChIKey of N-cyclohexyl-4-methylcyclohepta-1,3-diene-1-sulfinamide?
The InChIKey is UEHUTJDICNFQDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NOS/c1-12-6-5-9-14(11-10-12)17(16)15-13-7-3-2-4-8-13/h10-11,13,15H,2-9H2,1H3.
What are the key properties of N-cyclohexyl-4-methylcyclohepta-1,3-diene-1-sulfinamide?
N-cyclohexyl-4-methylcyclohepta-1,3-diene-1-sulfinamide has a molecular weight of 253.41 g/mol, XLogP of 3.59, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-4-methylcyclohepta-1,3-diene-1-sulfinamide is sourced from PubChem (CID 78027194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).