C35H53N7O2Si2 — CID 78028692
5-(3-bicyclo[3.2.1]octanyl)-3-[6-(1-methylpyrazol-3-yl)-3-pyridinyl]-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 78028692) has the molecular formula C35H53N7O2Si2 and a molecular weight of 660.03 g/mol. Its IUPAC name is 5-(3-bicyclo[3.2.1]octanyl)-3-[6-(1-methylpyrazol-3-yl)-3-pyridinyl]-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-(3-bicyclo[3.2.1]octanyl)-3-[6-(1-methylpyrazol-3-yl)-3-pyridinyl]-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 78028692 |
| Molecular Formula | C35H53N7O2Si2 |
| Molecular Weight | 660.03 g/mol |
| Exact Mass | 659.38 |
| IUPAC Name | 5-(3-bicyclo[3.2.1]octanyl)-3-[6-(1-methylpyrazol-3-yl)-3-pyridinyl]-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cn1ccc(-c2ccc(-c3cnn4c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)cc(C5CC6CCC(C6)C5)nc34)cn2)n1 |
| InChI | InChI=1S/C35H53N7O2Si2/c1-40-13-12-32(39-40)31-11-10-28(22-36-31)30-23-37-42-34(21-33(38-35(30)42)29-19-26-8-9-27(18-26)20-29)41(24-43-14-16-45(2,3)4)25-44-15-17-46(5,6)7/h10-13,21-23,26-27,29H,8-9,14-20,24-25H2,1-7H3 |
| InChIKey | WJAKXCKUTHPCNF-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 82.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.03 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|