C15H12ClFN2O4 — CID 7802880
[(2R)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 1-oxidopyridin-1-ium-2-carboxylate (PubChem CID 7802880) has the molecular formula C15H12ClFN2O4 and a molecular weight of 338.72 g/mol. Its IUPAC name is [(2R)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 1-oxidopyridin-1-ium-2-carboxylate.
| Compound Name | [(2R)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 1-oxidopyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 7802880 |
| Molecular Formula | C15H12ClFN2O4 |
| Molecular Weight | 338.72 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | [(2R)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 1-oxidopyridin-1-ium-2-carboxylate |
| SMILES | C[C@@H](OC(=O)c1cccc[n+]1[O-])C(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C15H12ClFN2O4/c1-9(23-15(21)13-4-2-3-7-19(13)22)14(20)18-12-6-5-10(17)8-11(12)16/h2-9H,1H3,(H,18,20)/t9-/m1/s1 |
| InChIKey | OJVNLTXIHVTWIR-SECBINFHSA-N |
| XLogP | 2.30 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.72 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|