C9H18N2O2S — CID 78031052
N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl)-N-methylmethanesulfonamide (PubChem CID 78031052) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl)-N-methylmethanesulfonamide.
| Compound Name | N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl)-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 78031052 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl)-N-methylmethanesulfonamide |
| SMILES | CN(C1CC2CNCC2C1)S(C)(=O)=O |
| InChI | InChI=1S/C9H18N2O2S/c1-11(14(2,12)13)9-3-7-5-10-6-8(7)4-9/h7-10H,3-6H2,1-2H3 |
| InChIKey | KEBRLBLRTIVSBA-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |