C30H24F5N5O2 — CID 78035742
5-[2-[1-[[2-[7-(difluoromethyl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(9),6-dien-8-yl]acetyl]amino]-2-(3,5-difluorophenyl)ethyl]-3-pyridinyl]-2-fluorobenzamide (PubChem CID 78035742) has the molecular formula C30H24F5N5O2 and a molecular weight of 581.55 g/mol. Its IUPAC name is 5-[2-[1-[[2-[7-(difluoromethyl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(9),6-dien-8-yl]acetyl]amino]-2-(3,5-difluorophenyl)ethyl]-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | 5-[2-[1-[[2-[7-(difluoromethyl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(9),6-dien-8-yl]acetyl]amino]-2-(3,5-difluorophenyl)ethyl]-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 78035742 |
| Molecular Formula | C30H24F5N5O2 |
| Molecular Weight | 581.55 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | 5-[2-[1-[[2-[7-(difluoromethyl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(9),6-dien-8-yl]acetyl]amino]-2-(3,5-difluorophenyl)ethyl]-3-pyridinyl]-2-fluorobenzamide |
| SMILES | NC(=O)c1cc(-c2cccnc2C(Cc2cc(F)cc(F)c2)NC(=O)Cn2nc3c(c2C(F)F)CC2CC32)ccc1F |
| InChI | InChI=1S/C30H24F5N5O2/c31-17-6-14(7-18(32)12-17)8-24(27-19(2-1-5-37-27)15-3-4-23(33)21(9-15)30(36)42)38-25(41)13-40-28(29(34)35)22-11-16-10-20(16)26(22)39-40/h1-7,9,12,16,20,24,29H,8,10-11,13H2,(H2,36,42)(H,38,41) |
| InChIKey | JOXDAQULCQKTGI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |