About N-phenyl-3,4-dihydroquinolin-2-amine
N-phenyl-3,4-dihydroquinolin-2-amine (PubChem CID 780385) has the molecular formula C15H14N2
and a molecular weight of 222.29 g/mol. Its IUPAC name is N-phenyl-3,4-dihydroquinolin-2-amine.
Molecular Properties
| Compound Name | N-phenyl-3,4-dihydroquinolin-2-amine |
| PubChem CID | 780385 |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | N-phenyl-3,4-dihydroquinolin-2-amine |
| SMILES | c1ccc(NC2=Nc3ccccc3CC2)cc1 |
| InChI | InChI=1S/C15H14N2/c1-2-7-13(8-3-1)16-15-11-10-12-6-4-5-9-14(12)17-15/h1-9H,10-11H2,(H,16,17) |
| InChIKey | FAQRBBKCMUZSRI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-phenyl-3,4-dihydroquinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-3,4-dihydroquinolin-2-amine?
The IUPAC name of N-phenyl-3,4-dihydroquinolin-2-amine (CID 780385) is N-phenyl-3,4-dihydroquinolin-2-amine.
What is the SMILES notation for N-phenyl-3,4-dihydroquinolin-2-amine?
The canonical SMILES for N-phenyl-3,4-dihydroquinolin-2-amine is c1ccc(NC2=Nc3ccccc3CC2)cc1.
What is the InChIKey of N-phenyl-3,4-dihydroquinolin-2-amine?
The InChIKey is FAQRBBKCMUZSRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2/c1-2-7-13(8-3-1)16-15-11-10-12-6-4-5-9-14(12)17-15/h1-9H,10-11H2,(H,16,17).
What are the key properties of N-phenyl-3,4-dihydroquinolin-2-amine?
N-phenyl-3,4-dihydroquinolin-2-amine has a molecular weight of 222.29 g/mol, XLogP of 3.77, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-3,4-dihydroquinolin-2-amine is sourced from PubChem (CID 780385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).