About 1-(3,4-dihydroquinolin-2-yl)-2-phenylhydrazine
1-(3,4-dihydroquinolin-2-yl)-2-phenylhydrazine (PubChem CID 780386) has the molecular formula C15H15N3
and a molecular weight of 237.31 g/mol. Its IUPAC name is 1-(3,4-dihydroquinolin-2-yl)-2-phenylhydrazine.
Molecular Properties
| Compound Name | 1-(3,4-dihydroquinolin-2-yl)-2-phenylhydrazine |
| PubChem CID | 780386 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 1-(3,4-dihydroquinolin-2-yl)-2-phenylhydrazine |
| SMILES | c1ccc(NNC2=Nc3ccccc3CC2)cc1 |
| InChI | InChI=1S/C15H15N3/c1-2-7-13(8-3-1)17-18-15-11-10-12-6-4-5-9-14(12)16-15/h1-9,17H,10-11H2,(H,16,18) |
| InChIKey | VGILMELVZDMKFG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4-dihydroquinolin-2-yl)-2-phenylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydroquinolin-2-yl)-2-phenylhydrazine?
The IUPAC name of 1-(3,4-dihydroquinolin-2-yl)-2-phenylhydrazine (CID 780386) is 1-(3,4-dihydroquinolin-2-yl)-2-phenylhydrazine.
What is the SMILES notation for 1-(3,4-dihydroquinolin-2-yl)-2-phenylhydrazine?
The canonical SMILES for 1-(3,4-dihydroquinolin-2-yl)-2-phenylhydrazine is c1ccc(NNC2=Nc3ccccc3CC2)cc1.
What is the InChIKey of 1-(3,4-dihydroquinolin-2-yl)-2-phenylhydrazine?
The InChIKey is VGILMELVZDMKFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3/c1-2-7-13(8-3-1)17-18-15-11-10-12-6-4-5-9-14(12)16-15/h1-9,17H,10-11H2,(H,16,18).
What are the key properties of 1-(3,4-dihydroquinolin-2-yl)-2-phenylhydrazine?
1-(3,4-dihydroquinolin-2-yl)-2-phenylhydrazine has a molecular weight of 237.31 g/mol, XLogP of 3.28, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydroquinolin-2-yl)-2-phenylhydrazine is sourced from PubChem (CID 780386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).