C22H24ClNO5 — CID 7804080
[2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] 2-(2-methoxy-4-prop-2-enylphenoxy)acetate (PubChem CID 7804080) has the molecular formula C22H24ClNO5 and a molecular weight of 417.89 g/mol. Its IUPAC name is [2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] 2-(2-methoxy-4-prop-2-enylphenoxy)acetate.
| Compound Name | [2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] 2-(2-methoxy-4-prop-2-enylphenoxy)acetate |
|---|---|
| PubChem CID | 7804080 |
| Molecular Formula | C22H24ClNO5 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | [2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] 2-(2-methoxy-4-prop-2-enylphenoxy)acetate |
| SMILES | C=CCc1ccc(OCC(=O)OCC(=O)Nc2c(C)cc(C)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C22H24ClNO5/c1-5-6-16-7-8-18(19(11-16)27-4)28-13-21(26)29-12-20(25)24-22-15(3)9-14(2)10-17(22)23/h5,7-11H,1,6,12-13H2,2-4H3,(H,24,25) |
| InChIKey | XIMTXOOVQAGXDM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|