About 2-N-[1-[5-(trifluoromethyl)pyrazin-2-yl]piperidin-3-yl]cyclohexane-1,2-diamine
2-N-[1-[5-(trifluoromethyl)pyrazin-2-yl]piperidin-3-yl]cyclohexane-1,2-diamine (PubChem CID 78043228) has the molecular formula C16H24F3N5
and a molecular weight of 343.40 g/mol. Its IUPAC name is 2-N-[1-[5-(trifluoromethyl)pyrazin-2-yl]piperidin-3-yl]cyclohexane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-[1-[5-(trifluoromethyl)pyrazin-2-yl]piperidin-3-yl]cyclohexane-1,2-diamine |
| PubChem CID | 78043228 |
| Molecular Formula | C16H24F3N5 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 2-N-[1-[5-(trifluoromethyl)pyrazin-2-yl]piperidin-3-yl]cyclohexane-1,2-diamine |
| SMILES | NC1CCCCC1NC1CCCN(c2cnc(C(F)(F)F)cn2)C1 |
| InChI | InChI=1S/C16H24F3N5/c17-16(18,19)14-8-22-15(9-21-14)24-7-3-4-11(10-24)23-13-6-2-1-5-12(13)20/h8-9,11-13,23H,1-7,10,20H2 |
| InChIKey | UAWKLDSCWYUULT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-N-[1-[5-(trifluoromethyl)pyrazin-2-yl]piperidin-3-yl]cyclohexane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[1-[5-(trifluoromethyl)pyrazin-2-yl]piperidin-3-yl]cyclohexane-1,2-diamine?
The IUPAC name of 2-N-[1-[5-(trifluoromethyl)pyrazin-2-yl]piperidin-3-yl]cyclohexane-1,2-diamine (CID 78043228) is 2-N-[1-[5-(trifluoromethyl)pyrazin-2-yl]piperidin-3-yl]cyclohexane-1,2-diamine.
What is the SMILES notation for 2-N-[1-[5-(trifluoromethyl)pyrazin-2-yl]piperidin-3-yl]cyclohexane-1,2-diamine?
The canonical SMILES for 2-N-[1-[5-(trifluoromethyl)pyrazin-2-yl]piperidin-3-yl]cyclohexane-1,2-diamine is NC1CCCCC1NC1CCCN(c2cnc(C(F)(F)F)cn2)C1.
What is the InChIKey of 2-N-[1-[5-(trifluoromethyl)pyrazin-2-yl]piperidin-3-yl]cyclohexane-1,2-diamine?
The InChIKey is UAWKLDSCWYUULT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24F3N5/c17-16(18,19)14-8-22-15(9-21-14)24-7-3-4-11(10-24)23-13-6-2-1-5-12(13)20/h8-9,11-13,23H,1-7,10,20H2.
What are the key properties of 2-N-[1-[5-(trifluoromethyl)pyrazin-2-yl]piperidin-3-yl]cyclohexane-1,2-diamine?
2-N-[1-[5-(trifluoromethyl)pyrazin-2-yl]piperidin-3-yl]cyclohexane-1,2-diamine has a molecular weight of 343.40 g/mol, XLogP of 2.32, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[1-[5-(trifluoromethyl)pyrazin-2-yl]piperidin-3-yl]cyclohexane-1,2-diamine is sourced from PubChem (CID 78043228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).