About N-(6-aminooxy-3,4-dihydroxyhexyl)-3-(2,5-dioxopyrrol-1-yl)propanamide
N-(6-aminooxy-3,4-dihydroxyhexyl)-3-(2,5-dioxopyrrol-1-yl)propanamide (PubChem CID 78044086) has the molecular formula C13H21N3O6
and a molecular weight of 315.33 g/mol. Its IUPAC name is N-(6-aminooxy-3,4-dihydroxyhexyl)-3-(2,5-dioxopyrrol-1-yl)propanamide.
Molecular Properties
| Compound Name | N-(6-aminooxy-3,4-dihydroxyhexyl)-3-(2,5-dioxopyrrol-1-yl)propanamide |
| PubChem CID | 78044086 |
| Molecular Formula | C13H21N3O6 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-(6-aminooxy-3,4-dihydroxyhexyl)-3-(2,5-dioxopyrrol-1-yl)propanamide |
| SMILES | NOCCC(O)C(O)CCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H21N3O6/c14-22-8-5-10(18)9(17)3-6-15-11(19)4-7-16-12(20)1-2-13(16)21/h1-2,9-10,17-18H,3-8,14H2,(H,15,19) |
| InChIKey | MQPZXJRMKBUYIV-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-(6-aminooxy-3,4-dihydroxyhexyl)-3-(2,5-dioxopyrrol-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-aminooxy-3,4-dihydroxyhexyl)-3-(2,5-dioxopyrrol-1-yl)propanamide?
The IUPAC name of N-(6-aminooxy-3,4-dihydroxyhexyl)-3-(2,5-dioxopyrrol-1-yl)propanamide (CID 78044086) is N-(6-aminooxy-3,4-dihydroxyhexyl)-3-(2,5-dioxopyrrol-1-yl)propanamide.
What is the SMILES notation for N-(6-aminooxy-3,4-dihydroxyhexyl)-3-(2,5-dioxopyrrol-1-yl)propanamide?
The canonical SMILES for N-(6-aminooxy-3,4-dihydroxyhexyl)-3-(2,5-dioxopyrrol-1-yl)propanamide is NOCCC(O)C(O)CCNC(=O)CCN1C(=O)C=CC1=O.
What is the InChIKey of N-(6-aminooxy-3,4-dihydroxyhexyl)-3-(2,5-dioxopyrrol-1-yl)propanamide?
The InChIKey is MQPZXJRMKBUYIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O6/c14-22-8-5-10(18)9(17)3-6-15-11(19)4-7-16-12(20)1-2-13(16)21/h1-2,9-10,17-18H,3-8,14H2,(H,15,19).
What are the key properties of N-(6-aminooxy-3,4-dihydroxyhexyl)-3-(2,5-dioxopyrrol-1-yl)propanamide?
N-(6-aminooxy-3,4-dihydroxyhexyl)-3-(2,5-dioxopyrrol-1-yl)propanamide has a molecular weight of 315.33 g/mol, XLogP of -2.19, 10 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-aminooxy-3,4-dihydroxyhexyl)-3-(2,5-dioxopyrrol-1-yl)propanamide is sourced from PubChem (CID 78044086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).