C13H20N2O6 — CID 78044129
3-(2,5-dioxopyrrol-1-yl)-N-(3,4,6-trihydroxyhexyl)propanamide (PubChem CID 78044129) has the molecular formula C13H20N2O6 and a molecular weight of 300.31 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-(3,4,6-trihydroxyhexyl)propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-(3,4,6-trihydroxyhexyl)propanamide |
|---|---|
| PubChem CID | 78044129 |
| Molecular Formula | C13H20N2O6 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-(3,4,6-trihydroxyhexyl)propanamide |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCCC(O)C(O)CCO |
| InChI | InChI=1S/C13H20N2O6/c16-8-5-10(18)9(17)3-6-14-11(19)4-7-15-12(20)1-2-13(15)21/h1-2,9-10,16-18H,3-8H2,(H,14,19) |
| InChIKey | OZEFSIACKYSHDE-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|