C17H27N5O3 — CID 78044446
4-[(3-hydroxycyclohexyl)amino]-2-[(4-methyloxan-4-yl)amino]pyrimidine-5-carboxamide (PubChem CID 78044446) has the molecular formula C17H27N5O3 and a molecular weight of 349.44 g/mol. Its IUPAC name is 4-[(3-hydroxycyclohexyl)amino]-2-[(4-methyloxan-4-yl)amino]pyrimidine-5-carboxamide.
| Compound Name | 4-[(3-hydroxycyclohexyl)amino]-2-[(4-methyloxan-4-yl)amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 78044446 |
| Molecular Formula | C17H27N5O3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | 4-[(3-hydroxycyclohexyl)amino]-2-[(4-methyloxan-4-yl)amino]pyrimidine-5-carboxamide |
| SMILES | CC1(Nc2ncc(C(N)=O)c(NC3CCCC(O)C3)n2)CCOCC1 |
| InChI | InChI=1S/C17H27N5O3/c1-17(5-7-25-8-6-17)22-16-19-10-13(14(18)24)15(21-16)20-11-3-2-4-12(23)9-11/h10-12,23H,2-9H2,1H3,(H2,18,24)(H2,19,20,21,22) |
| InChIKey | OYQLWCTXPPGDCK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |