About 4-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]pyrrolidin-2-one
4-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]pyrrolidin-2-one (PubChem CID 78045097) has the molecular formula C22H22N2O4
and a molecular weight of 378.43 g/mol. Its IUPAC name is 4-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]pyrrolidin-2-one |
| PubChem CID | 78045097 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 4-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]pyrrolidin-2-one |
| SMILES | COc1ccc(-c2cc(OCC3CNC(=O)C3)c3cccnc3c2)cc1OC |
| InChI | InChI=1S/C22H22N2O4/c1-26-19-6-5-15(10-21(19)27-2)16-9-18-17(4-3-7-23-18)20(11-16)28-13-14-8-22(25)24-12-14/h3-7,9-11,14H,8,12-13H2,1-2H3,(H,24,25) |
| InChIKey | MBQKOMPKUUJXNN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]pyrrolidin-2-one?
The IUPAC name of 4-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]pyrrolidin-2-one (CID 78045097) is 4-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]pyrrolidin-2-one.
What is the SMILES notation for 4-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]pyrrolidin-2-one?
The canonical SMILES for 4-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]pyrrolidin-2-one is COc1ccc(-c2cc(OCC3CNC(=O)C3)c3cccnc3c2)cc1OC.
What is the InChIKey of 4-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]pyrrolidin-2-one?
The InChIKey is MBQKOMPKUUJXNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O4/c1-26-19-6-5-15(10-21(19)27-2)16-9-18-17(4-3-7-23-18)20(11-16)28-13-14-8-22(25)24-12-14/h3-7,9-11,14H,8,12-13H2,1-2H3,(H,24,25).
What are the key properties of 4-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]pyrrolidin-2-one?
4-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]pyrrolidin-2-one has a molecular weight of 378.43 g/mol, XLogP of 3.43, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]pyrrolidin-2-one is sourced from PubChem (CID 78045097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).