C13H17ClN2O6S2 — CID 7804748
(2-morpholin-4-yl-2-oxoethyl) 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetate (PubChem CID 7804748) has the molecular formula C13H17ClN2O6S2 and a molecular weight of 396.87 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxoethyl) 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetate.
| Compound Name | (2-morpholin-4-yl-2-oxoethyl) 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 7804748 |
| Molecular Formula | C13H17ClN2O6S2 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | (2-morpholin-4-yl-2-oxoethyl) 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetate |
| SMILES | CN(CC(=O)OCC(=O)N1CCOCC1)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H17ClN2O6S2/c1-15(24(19,20)13-3-2-10(14)23-13)8-12(18)22-9-11(17)16-4-6-21-7-5-16/h2-3H,4-9H2,1H3 |
| InChIKey | CLJULZNGNYTCSW-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |