C22H33NO2Si — CID 78049395
5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-4-azatricyclo[7.6.0.03,7]pentadeca-1(9),2,5,7,14-pentaen-10-ol (PubChem CID 78049395) has the molecular formula C22H33NO2Si and a molecular weight of 371.60 g/mol. Its IUPAC name is 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-4-azatricyclo[7.6.0.03,7]pentadeca-1(9),2,5,7,14-pentaen-10-ol.
| Compound Name | 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-4-azatricyclo[7.6.0.03,7]pentadeca-1(9),2,5,7,14-pentaen-10-ol |
|---|---|
| PubChem CID | 78049395 |
| Molecular Formula | C22H33NO2Si |
| Molecular Weight | 371.60 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-4-azatricyclo[7.6.0.03,7]pentadeca-1(9),2,5,7,14-pentaen-10-ol |
| SMILES | Cn1c(CO[Si](C)(C)C(C)(C)C)cc2cc3c(cc21)C=CCCCC3O |
| InChI | InChI=1S/C22H33NO2Si/c1-22(2,3)26(5,6)25-15-18-12-17-13-19-16(14-20(17)23(18)4)10-8-7-9-11-21(19)24/h8,10,12-14,21,24H,7,9,11,15H2,1-6H3 |
| InChIKey | XTGIBYXFVNTSOW-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.60 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|