C12H22N4 — CID 78049991
N-ethyl-N-(2-hydrazinylideneethyl)-3,5,6-trimethyl-3,4-dihydropyridin-2-amine (PubChem CID 78049991) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is N-ethyl-N-(2-hydrazinylideneethyl)-3,5,6-trimethyl-3,4-dihydropyridin-2-amine.
| Compound Name | N-ethyl-N-(2-hydrazinylideneethyl)-3,5,6-trimethyl-3,4-dihydropyridin-2-amine |
|---|---|
| PubChem CID | 78049991 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | N-ethyl-N-(2-hydrazinylideneethyl)-3,5,6-trimethyl-3,4-dihydropyridin-2-amine |
| SMILES | CCN(CC=NN)C1=NC(C)=C(C)CC1C |
| InChI | InChI=1S/C12H22N4/c1-5-16(7-6-14-13)12-10(3)8-9(2)11(4)15-12/h6,10H,5,7-8,13H2,1-4H3 |
| InChIKey | MWJUMCAKCFTYNX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|