C15H14FN5O4 — CID 78051035
5-[4-[(1-amino-1-oxopropan-2-yl)amino]-6-carbamoylpyrimidin-2-yl]-2-fluorobenzoic acid (PubChem CID 78051035) has the molecular formula C15H14FN5O4 and a molecular weight of 347.31 g/mol. Its IUPAC name is 5-[4-[(1-amino-1-oxopropan-2-yl)amino]-6-carbamoylpyrimidin-2-yl]-2-fluorobenzoic acid.
| Compound Name | 5-[4-[(1-amino-1-oxopropan-2-yl)amino]-6-carbamoylpyrimidin-2-yl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 78051035 |
| Molecular Formula | C15H14FN5O4 |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 5-[4-[(1-amino-1-oxopropan-2-yl)amino]-6-carbamoylpyrimidin-2-yl]-2-fluorobenzoic acid |
| SMILES | CC(Nc1cc(C(N)=O)nc(-c2ccc(F)c(C(=O)O)c2)n1)C(N)=O |
| InChI | InChI=1S/C15H14FN5O4/c1-6(12(17)22)19-11-5-10(13(18)23)20-14(21-11)7-2-3-9(16)8(4-7)15(24)25/h2-6H,1H3,(H2,17,22)(H2,18,23)(H,24,25)(H,19,20,21) |
| InChIKey | BELZZKMDFRYGDZ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 161.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |