About [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate
[(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate (PubChem CID 7805252) has the molecular formula C20H18FNO3S2
and a molecular weight of 403.50 g/mol. Its IUPAC name is [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate.
Molecular Properties
| Compound Name | [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate |
| PubChem CID | 7805252 |
| Molecular Formula | C20H18FNO3S2 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1CSC1=NCCS1)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H18FNO3S2/c1-13(18(23)14-6-8-16(21)9-7-14)25-19(24)17-5-3-2-4-15(17)12-27-20-22-10-11-26-20/h2-9,13H,10-12H2,1H3/t13-/m0/s1 |
| InChIKey | DJLKPJZXKFAGSK-ZDUSSCGKSA-N |
| XLogP | 4.59 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate?
The IUPAC name of [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate (CID 7805252) is [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate.
What is the SMILES notation for [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate?
The canonical SMILES for [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate is C[C@H](OC(=O)c1ccccc1CSC1=NCCS1)C(=O)c1ccc(F)cc1.
What is the InChIKey of [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate?
The InChIKey is DJLKPJZXKFAGSK-ZDUSSCGKSA-N. The full InChI is InChI=1S/C20H18FNO3S2/c1-13(18(23)14-6-8-16(21)9-7-14)25-19(24)17-5-3-2-4-15(17)12-27-20-22-10-11-26-20/h2-9,13H,10-12H2,1H3/t13-/m0/s1.
What are the key properties of [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate?
[(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate has a molecular weight of 403.50 g/mol, XLogP of 4.59, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate is sourced from PubChem (CID 7805252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).