C19H30N8O — CID 78054643
1-[3-(6-piperazin-1-yl-2-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrazolo[3,4-c]pyridin-5-yl]piperazin-2-one (PubChem CID 78054643) has the molecular formula C19H30N8O and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-[3-(6-piperazin-1-yl-2-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrazolo[3,4-c]pyridin-5-yl]piperazin-2-one.
| Compound Name | 1-[3-(6-piperazin-1-yl-2-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrazolo[3,4-c]pyridin-5-yl]piperazin-2-one |
|---|---|
| PubChem CID | 78054643 |
| Molecular Formula | C19H30N8O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 1-[3-(6-piperazin-1-yl-2-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrazolo[3,4-c]pyridin-5-yl]piperazin-2-one |
| SMILES | O=C1CNCCN1C1CC2C(CN1)NNC2c1cccc(N2CCNCC2)n1 |
| InChI | InChI=1S/C19H30N8O/c28-18-12-21-6-9-27(18)17-10-13-15(11-22-17)24-25-19(13)14-2-1-3-16(23-14)26-7-4-20-5-8-26/h1-3,13,15,17,19-22,24-25H,4-12H2 |
| InChIKey | LDTCFVDKUDXGLX-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |