C14H16FN3O — CID 78060094
5-(1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazin-3-yl)-2-fluorobenzonitrile (PubChem CID 78060094) has the molecular formula C14H16FN3O and a molecular weight of 261.30 g/mol. Its IUPAC name is 5-(1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazin-3-yl)-2-fluorobenzonitrile.
| Compound Name | 5-(1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazin-3-yl)-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 78060094 |
| Molecular Formula | C14H16FN3O |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 5-(1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazin-3-yl)-2-fluorobenzonitrile |
| SMILES | N#Cc1cc(C2CN3CCNCC3CO2)ccc1F |
| InChI | InChI=1S/C14H16FN3O/c15-13-2-1-10(5-11(13)6-16)14-8-18-4-3-17-7-12(18)9-19-14/h1-2,5,12,14,17H,3-4,7-9H2 |
| InChIKey | RJEUKZIJMOUZGF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |