About {[(Chloromethyl)germanediyl]bis(methylene)}bis(trimethylsilane)
{[(Chloromethyl)germanediyl]bis(methylene)}bis(trimethylsilane) (PubChem CID 78060566) has the molecular formula C9H24ClGeSi2
and a molecular weight of 296.53 g/mol.
Molecular Properties
| Compound Name | {[(Chloromethyl)germanediyl]bis(methylene)}bis(trimethylsilane) |
| PubChem CID | 78060566 |
| Molecular Formula | C9H24ClGeSi2 |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)C[Ge](CCl)C[Si](C)(C)C |
| InChI | InChI=1S/C9H24ClGeSi2/c1-12(2,3)8-11(7-10)9-13(4,5)6/h7-9H2,1-6H3 |
| InChIKey | VUEGPZQCODGCKJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze {[(Chloromethyl)germanediyl]bis(methylene)}bis(trimethylsilane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of {[(Chloromethyl)germanediyl]bis(methylene)}bis(trimethylsilane)?
The IUPAC name of {[(Chloromethyl)germanediyl]bis(methylene)}bis(trimethylsilane) (CID 78060566) is not available.
What is the SMILES notation for {[(Chloromethyl)germanediyl]bis(methylene)}bis(trimethylsilane)?
The canonical SMILES for {[(Chloromethyl)germanediyl]bis(methylene)}bis(trimethylsilane) is C[Si](C)(C)C[Ge](CCl)C[Si](C)(C)C.
What is the InChIKey of {[(Chloromethyl)germanediyl]bis(methylene)}bis(trimethylsilane)?
The InChIKey is VUEGPZQCODGCKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H24ClGeSi2/c1-12(2,3)8-11(7-10)9-13(4,5)6/h7-9H2,1-6H3.
What are the key properties of {[(Chloromethyl)germanediyl]bis(methylene)}bis(trimethylsilane)?
{[(Chloromethyl)germanediyl]bis(methylene)}bis(trimethylsilane) has a molecular weight of 296.53 g/mol, XLogP of 4.01, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for {[(Chloromethyl)germanediyl]bis(methylene)}bis(trimethylsilane) is sourced from PubChem (CID 78060566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).