C21H18NO2Si — CID 78060596
2~4~-[(3-Silylpropyl)amino][1~1~,2~1~:2~3~,3~1~-terphenyl]-2~2~,2~5~-dione (PubChem CID 78060596) has the molecular formula C21H18NO2Si and a molecular weight of 344.47 g/mol.
| Compound Name | 2~4~-[(3-Silylpropyl)amino][1~1~,2~1~:2~3~,3~1~-terphenyl]-2~2~,2~5~-dione |
|---|---|
| PubChem CID | 78060596 |
| Molecular Formula | C21H18NO2Si |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | — |
| SMILES | O=C1C=C(c2ccccc2)C(=O)C(c2ccccc2)=C1NCCC[Si] |
| InChI | InChI=1S/C21H18NO2Si/c23-18-14-17(15-8-3-1-4-9-15)21(24)19(16-10-5-2-6-11-16)20(18)22-12-7-13-25/h1-6,8-11,14,22H,7,12-13H2 |
| InChIKey | SJTKVJDLKRGWSZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|