About magnesium;butane;pent-1-yne
magnesium;butane;pent-1-yne (PubChem CID 78060788) has the molecular formula C9H16Mg
and a molecular weight of 148.53 g/mol. Its IUPAC name is magnesium;butane;pent-1-yne.
Molecular Properties
| Compound Name | magnesium;butane;pent-1-yne |
| PubChem CID | 78060788 |
| Molecular Formula | C9H16Mg |
| Molecular Weight | 148.53 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | magnesium;butane;pent-1-yne |
| SMILES | [C-]#CCCC.[CH2-]CCC.[Mg+2] |
| InChI | InChI=1S/C5H7.C4H9.Mg/c1-3-5-4-2;1-3-4-2;/h3,5H2,1H3;1,3-4H2,2H3;/q2*-1;+2 |
| InChIKey | IMYXXVNFACRBNG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze magnesium;butane;pent-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;butane;pent-1-yne?
The IUPAC name of magnesium;butane;pent-1-yne (CID 78060788) is magnesium;butane;pent-1-yne.
What is the SMILES notation for magnesium;butane;pent-1-yne?
The canonical SMILES for magnesium;butane;pent-1-yne is [C-]#CCCC.[CH2-]CCC.[Mg+2].
What is the InChIKey of magnesium;butane;pent-1-yne?
The InChIKey is IMYXXVNFACRBNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7.C4H9.Mg/c1-3-5-4-2;1-3-4-2;/h3,5H2,1H3;1,3-4H2,2H3;/q2*-1;+2.
What are the key properties of magnesium;butane;pent-1-yne?
magnesium;butane;pent-1-yne has a molecular weight of 148.53 g/mol, XLogP of 2.62, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;butane;pent-1-yne is sourced from PubChem (CID 78060788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).