About 3,3'-{[(Methoxymethyl)silanediyl]bis(oxy)}di(propane-1,2-diol)
3,3'-{[(Methoxymethyl)silanediyl]bis(oxy)}di(propane-1,2-diol) (PubChem CID 78061102) has the molecular formula C8H19O7Si
and a molecular weight of 255.32 g/mol.
Molecular Properties
| Compound Name | 3,3'-{[(Methoxymethyl)silanediyl]bis(oxy)}di(propane-1,2-diol) |
| PubChem CID | 78061102 |
| Molecular Formula | C8H19O7Si |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | — |
| SMILES | COC[Si](OCC(O)CO)OCC(O)CO |
| InChI | InChI=1S/C8H19O7Si/c1-13-6-16(14-4-7(11)2-9)15-5-8(12)3-10/h7-12H,2-6H2,1H3 |
| InChIKey | XMPYVTQNWYIZDW-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3,3'-{[(Methoxymethyl)silanediyl]bis(oxy)}di(propane-1,2-diol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3'-{[(Methoxymethyl)silanediyl]bis(oxy)}di(propane-1,2-diol)?
The IUPAC name of 3,3'-{[(Methoxymethyl)silanediyl]bis(oxy)}di(propane-1,2-diol) (CID 78061102) is not available.
What is the SMILES notation for 3,3'-{[(Methoxymethyl)silanediyl]bis(oxy)}di(propane-1,2-diol)?
The canonical SMILES for 3,3'-{[(Methoxymethyl)silanediyl]bis(oxy)}di(propane-1,2-diol) is COC[Si](OCC(O)CO)OCC(O)CO.
What is the InChIKey of 3,3'-{[(Methoxymethyl)silanediyl]bis(oxy)}di(propane-1,2-diol)?
The InChIKey is XMPYVTQNWYIZDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19O7Si/c1-13-6-16(14-4-7(11)2-9)15-5-8(12)3-10/h7-12H,2-6H2,1H3.
What are the key properties of 3,3'-{[(Methoxymethyl)silanediyl]bis(oxy)}di(propane-1,2-diol)?
3,3'-{[(Methoxymethyl)silanediyl]bis(oxy)}di(propane-1,2-diol) has a molecular weight of 255.32 g/mol, XLogP of -2.60, 10 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3'-{[(Methoxymethyl)silanediyl]bis(oxy)}di(propane-1,2-diol) is sourced from PubChem (CID 78061102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).