About 2-Methyldisiloxan-2-ium
2-Methyldisiloxan-2-ium (PubChem CID 78061121) has the molecular formula CH3OSi2+
and a molecular weight of 87.21 g/mol.
Molecular Properties
| Compound Name | 2-Methyldisiloxan-2-ium |
| PubChem CID | 78061121 |
| Molecular Formula | CH3OSi2+ |
| Molecular Weight | 87.21 g/mol |
| Exact Mass | 86.97 |
| IUPAC Name | — |
| SMILES | C[O+]([Si])[Si] |
| InChI | InChI=1S/CH3OSi2/c1-2(3)4/h1H3/q+1 |
| InChIKey | KIIYNQOIDPEUTC-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 2.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 87.21 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-Methyldisiloxan-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Methyldisiloxan-2-ium?
The IUPAC name of 2-Methyldisiloxan-2-ium (CID 78061121) is not available.
What is the SMILES notation for 2-Methyldisiloxan-2-ium?
The canonical SMILES for 2-Methyldisiloxan-2-ium is C[O+]([Si])[Si].
What is the InChIKey of 2-Methyldisiloxan-2-ium?
The InChIKey is KIIYNQOIDPEUTC-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3OSi2/c1-2(3)4/h1H3/q+1.
What are the key properties of 2-Methyldisiloxan-2-ium?
2-Methyldisiloxan-2-ium has a molecular weight of 87.21 g/mol, XLogP of -0.66, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Methyldisiloxan-2-ium is sourced from PubChem (CID 78061121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).