About 3,3'-{[(4-Bromophenyl)methyl]silanediyl}bis(N,N-dimethylpropan-1-amine)
3,3'-{[(4-Bromophenyl)methyl]silanediyl}bis(N,N-dimethylpropan-1-amine) (PubChem CID 78061182) has the molecular formula C17H30BrN2Si
and a molecular weight of 370.43 g/mol.
Molecular Properties
| Compound Name | 3,3'-{[(4-Bromophenyl)methyl]silanediyl}bis(N,N-dimethylpropan-1-amine) |
| PubChem CID | 78061182 |
| Molecular Formula | C17H30BrN2Si |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | — |
| SMILES | CN(C)CCC[Si](CCCN(C)C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H30BrN2Si/c1-19(2)11-5-13-21(14-6-12-20(3)4)15-16-7-9-17(18)10-8-16/h7-10H,5-6,11-15H2,1-4H3 |
| InChIKey | HKZLDZZCBICQCP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3,3'-{[(4-Bromophenyl)methyl]silanediyl}bis(N,N-dimethylpropan-1-amine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3'-{[(4-Bromophenyl)methyl]silanediyl}bis(N,N-dimethylpropan-1-amine)?
The IUPAC name of 3,3'-{[(4-Bromophenyl)methyl]silanediyl}bis(N,N-dimethylpropan-1-amine) (CID 78061182) is not available.
What is the SMILES notation for 3,3'-{[(4-Bromophenyl)methyl]silanediyl}bis(N,N-dimethylpropan-1-amine)?
The canonical SMILES for 3,3'-{[(4-Bromophenyl)methyl]silanediyl}bis(N,N-dimethylpropan-1-amine) is CN(C)CCC[Si](CCCN(C)C)Cc1ccc(Br)cc1.
What is the InChIKey of 3,3'-{[(4-Bromophenyl)methyl]silanediyl}bis(N,N-dimethylpropan-1-amine)?
The InChIKey is HKZLDZZCBICQCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30BrN2Si/c1-19(2)11-5-13-21(14-6-12-20(3)4)15-16-7-9-17(18)10-8-16/h7-10H,5-6,11-15H2,1-4H3.
What are the key properties of 3,3'-{[(4-Bromophenyl)methyl]silanediyl}bis(N,N-dimethylpropan-1-amine)?
3,3'-{[(4-Bromophenyl)methyl]silanediyl}bis(N,N-dimethylpropan-1-amine) has a molecular weight of 370.43 g/mol, XLogP of 3.93, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3'-{[(4-Bromophenyl)methyl]silanediyl}bis(N,N-dimethylpropan-1-amine) is sourced from PubChem (CID 78061182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).