About [Boranetriyltri(ethane-2,1-diyl)]tris(methylsilane)
[Boranetriyltri(ethane-2,1-diyl)]tris(methylsilane) (PubChem CID 78062575) has the molecular formula C9H21BSi3
and a molecular weight of 224.34 g/mol.
Molecular Properties
| Compound Name | [Boranetriyltri(ethane-2,1-diyl)]tris(methylsilane) |
| PubChem CID | 78062575 |
| Molecular Formula | C9H21BSi3 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | — |
| SMILES | C[Si]CCB(CC[Si]C)CC[Si]C |
| InChI | InChI=1S/C9H21BSi3/c1-11-7-4-10(5-8-12-2)6-9-13-3/h4-9H2,1-3H3 |
| InChIKey | OJMZDMGKZFIWMY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [Boranetriyltri(ethane-2,1-diyl)]tris(methylsilane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [Boranetriyltri(ethane-2,1-diyl)]tris(methylsilane)?
The IUPAC name of [Boranetriyltri(ethane-2,1-diyl)]tris(methylsilane) (CID 78062575) is not available.
What is the SMILES notation for [Boranetriyltri(ethane-2,1-diyl)]tris(methylsilane)?
The canonical SMILES for [Boranetriyltri(ethane-2,1-diyl)]tris(methylsilane) is C[Si]CCB(CC[Si]C)CC[Si]C.
What is the InChIKey of [Boranetriyltri(ethane-2,1-diyl)]tris(methylsilane)?
The InChIKey is OJMZDMGKZFIWMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21BSi3/c1-11-7-4-10(5-8-12-2)6-9-13-3/h4-9H2,1-3H3.
What are the key properties of [Boranetriyltri(ethane-2,1-diyl)]tris(methylsilane)?
[Boranetriyltri(ethane-2,1-diyl)]tris(methylsilane) has a molecular weight of 224.34 g/mol, XLogP of 2.99, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [Boranetriyltri(ethane-2,1-diyl)]tris(methylsilane) is sourced from PubChem (CID 78062575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).