About copper(1+);1-ethynyl-2-iodobenzene
copper(1+);1-ethynyl-2-iodobenzene (PubChem CID 78062932) has the molecular formula C8H4CuI
and a molecular weight of 290.57 g/mol. Its IUPAC name is copper(1+);1-ethynyl-2-iodobenzene.
Molecular Properties
| Compound Name | copper(1+);1-ethynyl-2-iodobenzene |
| PubChem CID | 78062932 |
| Molecular Formula | C8H4CuI |
| Molecular Weight | 290.57 g/mol |
| Exact Mass | 289.87 |
| IUPAC Name | copper(1+);1-ethynyl-2-iodobenzene |
| SMILES | [C-]#Cc1ccccc1I.[Cu+] |
| InChI | InChI=1S/C8H4I.Cu/c1-2-7-5-3-4-6-8(7)9;/h3-6H;/q-1;+1 |
| InChIKey | JIFQQKMNQSWEAB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.57 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);1-ethynyl-2-iodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);1-ethynyl-2-iodobenzene?
The IUPAC name of copper(1+);1-ethynyl-2-iodobenzene (CID 78062932) is copper(1+);1-ethynyl-2-iodobenzene.
What is the SMILES notation for copper(1+);1-ethynyl-2-iodobenzene?
The canonical SMILES for copper(1+);1-ethynyl-2-iodobenzene is [C-]#Cc1ccccc1I.[Cu+].
What is the InChIKey of copper(1+);1-ethynyl-2-iodobenzene?
The InChIKey is JIFQQKMNQSWEAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4I.Cu/c1-2-7-5-3-4-6-8(7)9;/h3-6H;/q-1;+1.
What are the key properties of copper(1+);1-ethynyl-2-iodobenzene?
copper(1+);1-ethynyl-2-iodobenzene has a molecular weight of 290.57 g/mol, XLogP of 2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);1-ethynyl-2-iodobenzene is sourced from PubChem (CID 78062932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).