About CID 78063614
CID 78063614 (PubChem CID 78063614) has the molecular formula C24H54Pb2
and a molecular weight of 757.10 g/mol.
Molecular Properties
| Compound Name | CID 78063614 |
| PubChem CID | 78063614 |
| Molecular Formula | C24H54Pb2 |
| Molecular Weight | 757.10 g/mol |
| Exact Mass | 758.38 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Pb](C(C)(C)C)C(C)(C)C.CC(C)(C)[Pb](C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/6C4H9.2Pb/c6*1-4(2)3;;/h6*1-3H3;; |
| InChIKey | RJGYQYAQIWCCFC-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 757.10 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 78063614 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 78063614?
The IUPAC name of CID 78063614 (CID 78063614) is not available.
What is the SMILES notation for CID 78063614?
The canonical SMILES for CID 78063614 is CC(C)(C)[Pb](C(C)(C)C)C(C)(C)C.CC(C)(C)[Pb](C(C)(C)C)C(C)(C)C.
What is the InChIKey of CID 78063614?
The InChIKey is RJGYQYAQIWCCFC-UHFFFAOYSA-N. The full InChI is InChI=1S/6C4H9.2Pb/c6*1-4(2)3;;/h6*1-3H3;;.
What are the key properties of CID 78063614?
CID 78063614 has a molecular weight of 757.10 g/mol, XLogP of 9.76, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 78063614 is sourced from PubChem (CID 78063614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).