C4H2Cl8Si2 — CID 78064229
(1,1,2,2-Tetrachloroethane-1,2-diyl)bis[(dichloromethyl)silane] (PubChem CID 78064229) has the molecular formula C4H2Cl8Si2 and a molecular weight of 389.86 g/mol.
| Compound Name | (1,1,2,2-Tetrachloroethane-1,2-diyl)bis[(dichloromethyl)silane] |
|---|---|
| PubChem CID | 78064229 |
| Molecular Formula | C4H2Cl8Si2 |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 385.72 |
| IUPAC Name | — |
| SMILES | ClC(Cl)[Si]C(Cl)(Cl)C(Cl)(Cl)[Si]C(Cl)Cl |
| InChI | InChI=1S/C4H2Cl8Si2/c5-1(6)13-3(9,10)4(11,12)14-2(7)8/h1-2H |
| InChIKey | LLCVUBDVFKMLFW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|