About 2,4-diazidopentane
2,4-diazidopentane (PubChem CID 78066525) has the molecular formula C5H10N6
and a molecular weight of 154.18 g/mol. Its IUPAC name is 2,4-diazidopentane.
Molecular Properties
| Compound Name | 2,4-diazidopentane |
| PubChem CID | 78066525 |
| Molecular Formula | C5H10N6 |
| Molecular Weight | 154.18 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 2,4-diazidopentane |
| SMILES | CC(CC(C)N=[N+]=[N-])N=[N+]=[N-] |
| InChI | InChI=1S/C5H10N6/c1-4(8-10-6)3-5(2)9-11-7/h4-5H,3H2,1-2H3 |
| InChIKey | AWJFANPWIBNSDY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.18 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diazidopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diazidopentane?
The IUPAC name of 2,4-diazidopentane (CID 78066525) is 2,4-diazidopentane.
What is the SMILES notation for 2,4-diazidopentane?
The canonical SMILES for 2,4-diazidopentane is CC(CC(C)N=[N+]=[N-])N=[N+]=[N-].
What is the InChIKey of 2,4-diazidopentane?
The InChIKey is AWJFANPWIBNSDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N6/c1-4(8-10-6)3-5(2)9-11-7/h4-5H,3H2,1-2H3.
What are the key properties of 2,4-diazidopentane?
2,4-diazidopentane has a molecular weight of 154.18 g/mol, XLogP of 2.77, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diazidopentane is sourced from PubChem (CID 78066525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).