About 4-{[3-(Diethylsilyl)prop-2-YN-1-YL]oxy}butan-1-OL
4-{[3-(Diethylsilyl)prop-2-YN-1-YL]oxy}butan-1-OL (PubChem CID 78067307) has the molecular formula C11H21O2Si
and a molecular weight of 213.37 g/mol.
Molecular Properties
| Compound Name | 4-{[3-(Diethylsilyl)prop-2-YN-1-YL]oxy}butan-1-OL |
| PubChem CID | 78067307 |
| Molecular Formula | C11H21O2Si |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | — |
| SMILES | CC[Si](C#CCOCCCCO)CC |
| InChI | InChI=1S/C11H21O2Si/c1-3-14(4-2)11-7-10-13-9-6-5-8-12/h12H,3-6,8-10H2,1-2H3 |
| InChIKey | DZKDZZRSQGPCLM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-{[3-(Diethylsilyl)prop-2-YN-1-YL]oxy}butan-1-OL with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-{[3-(Diethylsilyl)prop-2-YN-1-YL]oxy}butan-1-OL?
The IUPAC name of 4-{[3-(Diethylsilyl)prop-2-YN-1-YL]oxy}butan-1-OL (CID 78067307) is not available.
What is the SMILES notation for 4-{[3-(Diethylsilyl)prop-2-YN-1-YL]oxy}butan-1-OL?
The canonical SMILES for 4-{[3-(Diethylsilyl)prop-2-YN-1-YL]oxy}butan-1-OL is CC[Si](C#CCOCCCCO)CC.
What is the InChIKey of 4-{[3-(Diethylsilyl)prop-2-YN-1-YL]oxy}butan-1-OL?
The InChIKey is DZKDZZRSQGPCLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21O2Si/c1-3-14(4-2)11-7-10-13-9-6-5-8-12/h12H,3-6,8-10H2,1-2H3.
What are the key properties of 4-{[3-(Diethylsilyl)prop-2-YN-1-YL]oxy}butan-1-OL?
4-{[3-(Diethylsilyl)prop-2-YN-1-YL]oxy}butan-1-OL has a molecular weight of 213.37 g/mol, XLogP of 1.85, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-{[3-(Diethylsilyl)prop-2-YN-1-YL]oxy}butan-1-OL is sourced from PubChem (CID 78067307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).