About [Di(4,5-dihydrofuran-2-yl)methyl]silane
[Di(4,5-dihydrofuran-2-yl)methyl]silane (PubChem CID 78067895) has the molecular formula C9H11O2Si
and a molecular weight of 179.27 g/mol.
Molecular Properties
| Compound Name | [Di(4,5-dihydrofuran-2-yl)methyl]silane |
| PubChem CID | 78067895 |
| Molecular Formula | C9H11O2Si |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | — |
| SMILES | [Si]C(C1=CCCO1)C1=CCCO1 |
| InChI | InChI=1S/C9H11O2Si/c12-9(7-3-1-5-10-7)8-4-2-6-11-8/h3-4,9H,1-2,5-6H2 |
| InChIKey | JRZUMYBLVBBGET-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [Di(4,5-dihydrofuran-2-yl)methyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [Di(4,5-dihydrofuran-2-yl)methyl]silane?
The IUPAC name of [Di(4,5-dihydrofuran-2-yl)methyl]silane (CID 78067895) is not available.
What is the SMILES notation for [Di(4,5-dihydrofuran-2-yl)methyl]silane?
The canonical SMILES for [Di(4,5-dihydrofuran-2-yl)methyl]silane is [Si]C(C1=CCCO1)C1=CCCO1.
What is the InChIKey of [Di(4,5-dihydrofuran-2-yl)methyl]silane?
The InChIKey is JRZUMYBLVBBGET-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11O2Si/c12-9(7-3-1-5-10-7)8-4-2-6-11-8/h3-4,9H,1-2,5-6H2.
What are the key properties of [Di(4,5-dihydrofuran-2-yl)methyl]silane?
[Di(4,5-dihydrofuran-2-yl)methyl]silane has a molecular weight of 179.27 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [Di(4,5-dihydrofuran-2-yl)methyl]silane is sourced from PubChem (CID 78067895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).