About 2-but-3-enyl-1,6-dioxaspiro[4.4]nonane
2-but-3-enyl-1,6-dioxaspiro[4.4]nonane (PubChem CID 78068843) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is 2-but-3-enyl-1,6-dioxaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 2-but-3-enyl-1,6-dioxaspiro[4.4]nonane |
| PubChem CID | 78068843 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 2-but-3-enyl-1,6-dioxaspiro[4.4]nonane |
| SMILES | C=CCCC1CCC2(CCCO2)O1 |
| InChI | InChI=1S/C11H18O2/c1-2-3-5-10-6-8-11(13-10)7-4-9-12-11/h2,10H,1,3-9H2 |
| InChIKey | RSDHUZXFIDRLHR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-but-3-enyl-1,6-dioxaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-3-enyl-1,6-dioxaspiro[4.4]nonane?
The IUPAC name of 2-but-3-enyl-1,6-dioxaspiro[4.4]nonane (CID 78068843) is 2-but-3-enyl-1,6-dioxaspiro[4.4]nonane.
What is the SMILES notation for 2-but-3-enyl-1,6-dioxaspiro[4.4]nonane?
The canonical SMILES for 2-but-3-enyl-1,6-dioxaspiro[4.4]nonane is C=CCCC1CCC2(CCCO2)O1.
What is the InChIKey of 2-but-3-enyl-1,6-dioxaspiro[4.4]nonane?
The InChIKey is RSDHUZXFIDRLHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-2-3-5-10-6-8-11(13-10)7-4-9-12-11/h2,10H,1,3-9H2.
What are the key properties of 2-but-3-enyl-1,6-dioxaspiro[4.4]nonane?
2-but-3-enyl-1,6-dioxaspiro[4.4]nonane has a molecular weight of 182.26 g/mol, XLogP of 2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-3-enyl-1,6-dioxaspiro[4.4]nonane is sourced from PubChem (CID 78068843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).