About CID 78070001
CID 78070001 (PubChem CID 78070001) has the molecular formula C18H54Si8Zn
and a molecular weight of 560.71 g/mol.
Molecular Properties
| Compound Name | CID 78070001 |
| PubChem CID | 78070001 |
| Molecular Formula | C18H54Si8Zn |
| Molecular Weight | 560.71 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)[Si]([Si](C)(C)C)[Si](C)(C)C.C[Si](C)(C)[Si]([Si](C)(C)C)[Si](C)(C)C.[Zn] |
| InChI | InChI=1S/2C9H27Si4.Zn/c2*1-11(2,3)10(12(4,5)6)13(7,8)9;/h2*1-9H3; |
| InChIKey | JOPVAAWEWWZZDK-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 560.71 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 78070001 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 78070001?
The IUPAC name of CID 78070001 (CID 78070001) is not available.
What is the SMILES notation for CID 78070001?
The canonical SMILES for CID 78070001 is C[Si](C)(C)[Si]([Si](C)(C)C)[Si](C)(C)C.C[Si](C)(C)[Si]([Si](C)(C)C)[Si](C)(C)C.[Zn].
What is the InChIKey of CID 78070001?
The InChIKey is JOPVAAWEWWZZDK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H27Si4.Zn/c2*1-11(2,3)10(12(4,5)6)13(7,8)9;/h2*1-9H3;.
What are the key properties of CID 78070001?
CID 78070001 has a molecular weight of 560.71 g/mol, XLogP of 7.46, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 78070001 is sourced from PubChem (CID 78070001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).