C42H69N5O10 — CID 78070893
3-butan-2-yl-16-(1-hydroxyethyl)-7,12,12,20-tetramethyl-13-pent-4-ynyl-6,9,19-tri(propan-2-yl)-4,14-dioxa-1,7,10,17,20-pentazabicyclo[20.3.0]pentacosane-2,5,8,11,15,18,21-heptone (PubChem CID 78070893) has the molecular formula C42H69N5O10 and a molecular weight of 804.04 g/mol. Its IUPAC name is 3-butan-2-yl-16-(1-hydroxyethyl)-7,12,12,20-tetramethyl-13-pent-4-ynyl-6,9,19-tri(propan-2-yl)-4,14-dioxa-1,7,10,17,20-pentazabicyclo[20.3.0]pentacosane-2,5,8,11,15,18,21-heptone.
| Compound Name | 3-butan-2-yl-16-(1-hydroxyethyl)-7,12,12,20-tetramethyl-13-pent-4-ynyl-6,9,19-tri(propan-2-yl)-4,14-dioxa-1,7,10,17,20-pentazabicyclo[20.3.0]pentacosane-2,5,8,11,15,18,21-heptone |
|---|---|
| PubChem CID | 78070893 |
| Molecular Formula | C42H69N5O10 |
| Molecular Weight | 804.04 g/mol |
| Exact Mass | 803.50 |
| IUPAC Name | 3-butan-2-yl-16-(1-hydroxyethyl)-7,12,12,20-tetramethyl-13-pent-4-ynyl-6,9,19-tri(propan-2-yl)-4,14-dioxa-1,7,10,17,20-pentazabicyclo[20.3.0]pentacosane-2,5,8,11,15,18,21-heptone |
| SMILES | C#CCCCC1OC(=O)C(C(C)O)NC(=O)C(C(C)C)N(C)C(=O)C2CCCN2C(=O)C(C(C)CC)OC(=O)C(C(C)C)N(C)C(=O)C(C(C)C)NC(=O)C1(C)C |
| InChI | InChI=1S/C42H69N5O10/c1-15-17-18-21-29-42(11,12)41(55)44-30(23(3)4)37(51)46(14)33(25(7)8)40(54)57-34(26(9)16-2)38(52)47-22-19-20-28(47)36(50)45(13)32(24(5)6)35(49)43-31(27(10)48)39(53)56-29/h1,23-34,48H,16-22H2,2-14H3,(H,43,49)(H,44,55) |
| InChIKey | WRHBDNJXUOKAGU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 191.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.04 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|