About N-(1-adamantyl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide
N-(1-adamantyl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide (PubChem CID 7807395) has the molecular formula C18H23N3O4
and a molecular weight of 345.40 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(1-adamantyl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide |
| PubChem CID | 7807395 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-(1-adamantyl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide |
| SMILES | C=CCN1C(=O)C(=O)N(CC(=O)NC23CC4CC(CC(C4)C2)C3)C1=O |
| InChI | InChI=1S/C18H23N3O4/c1-2-3-20-15(23)16(24)21(17(20)25)10-14(22)19-18-7-11-4-12(8-18)6-13(5-11)9-18/h2,11-13H,1,3-10H2,(H,19,22) |
| InChIKey | NUGATVWXRFDLPR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(1-adamantyl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-adamantyl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide?
The IUPAC name of N-(1-adamantyl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide (CID 7807395) is N-(1-adamantyl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide.
What is the SMILES notation for N-(1-adamantyl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide?
The canonical SMILES for N-(1-adamantyl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide is C=CCN1C(=O)C(=O)N(CC(=O)NC23CC4CC(CC(C4)C2)C3)C1=O.
What is the InChIKey of N-(1-adamantyl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide?
The InChIKey is NUGATVWXRFDLPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O4/c1-2-3-20-15(23)16(24)21(17(20)25)10-14(22)19-18-7-11-4-12(8-18)6-13(5-11)9-18/h2,11-13H,1,3-10H2,(H,19,22).
What are the key properties of N-(1-adamantyl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide?
N-(1-adamantyl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide has a molecular weight of 345.40 g/mol, XLogP of 1.05, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-adamantyl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide is sourced from PubChem (CID 7807395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).