C19H20N6O — CID 780750
6-morpholin-4-yl-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine (PubChem CID 780750) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is 6-morpholin-4-yl-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-morpholin-4-yl-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 780750 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 6-morpholin-4-yl-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine |
| SMILES | c1ccc(Nc2nc(Nc3ccccc3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C19H20N6O/c1-3-7-15(8-4-1)20-17-22-18(21-16-9-5-2-6-10-16)24-19(23-17)25-11-13-26-14-12-25/h1-10H,11-14H2,(H2,20,21,22,23,24) |
| InChIKey | GSXOUQFSYTZEJF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |