C25H23NO5 — CID 7807565
[(2S)-1-(4-methylanilino)-1-oxopropan-2-yl] 4-(4-acetyloxyphenyl)benzoate (PubChem CID 7807565) has the molecular formula C25H23NO5 and a molecular weight of 417.46 g/mol. Its IUPAC name is [(2S)-1-(4-methylanilino)-1-oxopropan-2-yl] 4-(4-acetyloxyphenyl)benzoate.
| Compound Name | [(2S)-1-(4-methylanilino)-1-oxopropan-2-yl] 4-(4-acetyloxyphenyl)benzoate |
|---|---|
| PubChem CID | 7807565 |
| Molecular Formula | C25H23NO5 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | [(2S)-1-(4-methylanilino)-1-oxopropan-2-yl] 4-(4-acetyloxyphenyl)benzoate |
| SMILES | CC(=O)Oc1ccc(-c2ccc(C(=O)O[C@@H](C)C(=O)Nc3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H23NO5/c1-16-4-12-22(13-5-16)26-24(28)17(2)30-25(29)21-8-6-19(7-9-21)20-10-14-23(15-11-20)31-18(3)27/h4-15,17H,1-3H3,(H,26,28)/t17-/m0/s1 |
| InChIKey | UGBJLACMFCQFIZ-KRWDZBQOSA-N |
| XLogP | 4.77 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|