C23H24NOP — CID 78076218
diphenyl-[2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)cyclopenta-1,3-dien-1-yl]phosphane (PubChem CID 78076218) has the molecular formula C23H24NOP and a molecular weight of 361.43 g/mol. Its IUPAC name is diphenyl-[2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)cyclopenta-1,3-dien-1-yl]phosphane.
| Compound Name | diphenyl-[2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)cyclopenta-1,3-dien-1-yl]phosphane |
|---|---|
| PubChem CID | 78076218 |
| Molecular Formula | C23H24NOP |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | diphenyl-[2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)cyclopenta-1,3-dien-1-yl]phosphane |
| SMILES | CC(C)C1COC(C2=C(P(c3ccccc3)c3ccccc3)CC=C2)=N1 |
| InChI | InChI=1S/C23H24NOP/c1-17(2)21-16-25-23(24-21)20-14-9-15-22(20)26(18-10-5-3-6-11-18)19-12-7-4-8-13-19/h3-14,17,21H,15-16H2,1-2H3 |
| InChIKey | PVFPDYSENLUOEP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|