C20H20FN3O — CID 78076645
6-(4-fluorophenyl)-N-[1-(3-methoxyphenyl)ethyl]-2-methylpyrimidin-4-amine (PubChem CID 78076645) has the molecular formula C20H20FN3O and a molecular weight of 337.40 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-N-[1-(3-methoxyphenyl)ethyl]-2-methylpyrimidin-4-amine.
| Compound Name | 6-(4-fluorophenyl)-N-[1-(3-methoxyphenyl)ethyl]-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 78076645 |
| Molecular Formula | C20H20FN3O |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 6-(4-fluorophenyl)-N-[1-(3-methoxyphenyl)ethyl]-2-methylpyrimidin-4-amine |
| SMILES | COc1cccc(C(C)Nc2cc(-c3ccc(F)cc3)nc(C)n2)c1 |
| InChI | InChI=1S/C20H20FN3O/c1-13(16-5-4-6-18(11-16)25-3)22-20-12-19(23-14(2)24-20)15-7-9-17(21)10-8-15/h4-13H,1-3H3,(H,22,23,24) |
| InChIKey | IJQIEDAIFBVIPJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |