C19H22ClN5O4S2 — CID 78077550
5-(3-amino-2-methyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[3,4-e][1,2,4]thiadiazin-4a-yl)-4-chloro-N-(6-ethyl-2-pyridinyl)thiophene-2-carboxamide (PubChem CID 78077550) has the molecular formula C19H22ClN5O4S2 and a molecular weight of 484.00 g/mol. Its IUPAC name is 5-(3-amino-2-methyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[3,4-e][1,2,4]thiadiazin-4a-yl)-4-chloro-N-(6-ethyl-2-pyridinyl)thiophene-2-carboxamide.
| Compound Name | 5-(3-amino-2-methyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[3,4-e][1,2,4]thiadiazin-4a-yl)-4-chloro-N-(6-ethyl-2-pyridinyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78077550 |
| Molecular Formula | C19H22ClN5O4S2 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | 5-(3-amino-2-methyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[3,4-e][1,2,4]thiadiazin-4a-yl)-4-chloro-N-(6-ethyl-2-pyridinyl)thiophene-2-carboxamide |
| SMILES | CCc1cccc(NC(=O)c2cc(Cl)c(C34COCCC3S(=O)(=O)N(C)C(N)=N4)s2)n1 |
| InChI | InChI=1S/C19H22ClN5O4S2/c1-3-11-5-4-6-15(22-11)23-17(26)13-9-12(20)16(30-13)19-10-29-8-7-14(19)31(27,28)25(2)18(21)24-19/h4-6,9,14H,3,7-8,10H2,1-2H3,(H2,21,24)(H,22,23,26) |
| InChIKey | DUXKUHRTNQVICH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 126.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |