C17H15ClF3N5O4S2 — CID 78078161
5-(3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl)-4-chloro-N-[6-(trifluoromethyl)-2-pyridinyl]thiophene-2-carboxamide (PubChem CID 78078161) has the molecular formula C17H15ClF3N5O4S2 and a molecular weight of 509.92 g/mol. Its IUPAC name is 5-(3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl)-4-chloro-N-[6-(trifluoromethyl)-2-pyridinyl]thiophene-2-carboxamide.
| Compound Name | 5-(3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl)-4-chloro-N-[6-(trifluoromethyl)-2-pyridinyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78078161 |
| Molecular Formula | C17H15ClF3N5O4S2 |
| Molecular Weight | 509.92 g/mol |
| Exact Mass | 509.02 |
| IUPAC Name | 5-(3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl)-4-chloro-N-[6-(trifluoromethyl)-2-pyridinyl]thiophene-2-carboxamide |
| SMILES | CN1C(N)=NC2(c3sc(C(=O)Nc4cccc(C(F)(F)F)n4)cc3Cl)COCC2S1(=O)=O |
| InChI | InChI=1S/C17H15ClF3N5O4S2/c1-26-15(22)25-16(7-30-6-11(16)32(26,28)29)13-8(18)5-9(31-13)14(27)24-12-4-2-3-10(23-12)17(19,20)21/h2-5,11H,6-7H2,1H3,(H2,22,25)(H,23,24,27) |
| InChIKey | JTCSBDQPDAOAAR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 126.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.92 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |