C16H27F4NO — CID 78078417
N-(1,1,1,4-tetrafluorotetradec-4-en-2-yl)acetamide (PubChem CID 78078417) has the molecular formula C16H27F4NO and a molecular weight of 325.39 g/mol. Its IUPAC name is N-(1,1,1,4-tetrafluorotetradec-4-en-2-yl)acetamide.
| Compound Name | N-(1,1,1,4-tetrafluorotetradec-4-en-2-yl)acetamide |
|---|---|
| PubChem CID | 78078417 |
| Molecular Formula | C16H27F4NO |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | N-(1,1,1,4-tetrafluorotetradec-4-en-2-yl)acetamide |
| SMILES | CCCCCCCCCC=C(F)CC(NC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C16H27F4NO/c1-3-4-5-6-7-8-9-10-11-14(17)12-15(16(18,19)20)21-13(2)22/h11,15H,3-10,12H2,1-2H3,(H,21,22) |
| InChIKey | KASGLLIYHOODDC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|